C16H14Cl2N2O4S — CID 9001996
[(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 9001996) has the molecular formula C16H14Cl2N2O4S and a molecular weight of 401.27 g/mol. Its IUPAC name is [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 9001996 |
| Molecular Formula | C16H14Cl2N2O4S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | C[C@@H](OC(=O)CCC(=O)c1ccc(Cl)s1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H14Cl2N2O4S/c1-9(16(23)20-10-3-2-8-19-15(10)18)24-14(22)7-4-11(21)12-5-6-13(17)25-12/h2-3,5-6,8-9H,4,7H2,1H3,(H,20,23)/t9-/m1/s1 |
| InChIKey | ZLXNRYBTJWFGPL-SECBINFHSA-N |
| XLogP | 3.98 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|