C17H15ClFNO4S — CID 9001957
[(2R)-1-(3-fluoroanilino)-1-oxopropan-2-yl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 9001957) has the molecular formula C17H15ClFNO4S and a molecular weight of 383.83 g/mol. Its IUPAC name is [(2R)-1-(3-fluoroanilino)-1-oxopropan-2-yl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | [(2R)-1-(3-fluoroanilino)-1-oxopropan-2-yl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 9001957 |
| Molecular Formula | C17H15ClFNO4S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | [(2R)-1-(3-fluoroanilino)-1-oxopropan-2-yl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | C[C@@H](OC(=O)CCC(=O)c1ccc(Cl)s1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H15ClFNO4S/c1-10(17(23)20-12-4-2-3-11(19)9-12)24-16(22)8-5-13(21)14-6-7-15(18)25-14/h2-4,6-7,9-10H,5,8H2,1H3,(H,20,23)/t10-/m1/s1 |
| InChIKey | CFLYPPMUHCQOMD-SNVBAGLBSA-N |
| XLogP | 4.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |