C15H12Cl2N2O4 — CID 8888887
[(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-chloro-2-hydroxybenzoate (PubChem CID 8888887) has the molecular formula C15H12Cl2N2O4 and a molecular weight of 355.18 g/mol. Its IUPAC name is [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 8888887 |
| Molecular Formula | C15H12Cl2N2O4 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-chloro-2-hydroxybenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(Cl)cc1O)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O4/c1-8(14(21)19-11-3-2-6-18-13(11)17)23-15(22)10-5-4-9(16)7-12(10)20/h2-8,20H,1H3,(H,19,21)/t8-/m1/s1 |
| InChIKey | NTWOSCAILWDSBY-MRVPVSSYSA-N |
| XLogP | 3.28 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|