C17H17ClN2O4S — CID 11936026
[(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 2-[(R)-ethylsulfinyl]benzoate (PubChem CID 11936026) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 2-[(R)-ethylsulfinyl]benzoate.
| Compound Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 2-[(R)-ethylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11936026 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 2-[(R)-ethylsulfinyl]benzoate |
| SMILES | CC[S@@](=O)c1ccccc1C(=O)O[C@@H](C)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H17ClN2O4S/c1-3-25(23)14-9-5-4-7-12(14)17(22)24-11(2)16(21)20-13-8-6-10-19-15(13)18/h4-11H,3H2,1-2H3,(H,20,21)/t11-,25+/m0/s1 |
| InChIKey | HIGNZOCGNTXCCC-JPQMIFPKSA-N |
| XLogP | 3.05 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|