C13H13Br2NO3 — CID 107738304
2-(2,6-dibromo-4-formylphenoxy)-N-prop-2-enylpropanamide (PubChem CID 107738304) has the molecular formula C13H13Br2NO3 and a molecular weight of 391.06 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-formylphenoxy)-N-prop-2-enylpropanamide.
| Compound Name | 2-(2,6-dibromo-4-formylphenoxy)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 107738304 |
| Molecular Formula | C13H13Br2NO3 |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | 2-(2,6-dibromo-4-formylphenoxy)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Oc1c(Br)cc(C=O)cc1Br |
| InChI | InChI=1S/C13H13Br2NO3/c1-3-4-16-13(18)8(2)19-12-10(14)5-9(7-17)6-11(12)15/h3,5-8H,1,4H2,2H3,(H,16,18) |
| InChIKey | RFORCPQOILAFMT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|