C17H14BrF2NO3 — CID 8975537
[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-bromo-4-fluorobenzoate (PubChem CID 8975537) has the molecular formula C17H14BrF2NO3 and a molecular weight of 398.20 g/mol. Its IUPAC name is [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-bromo-4-fluorobenzoate.
| Compound Name | [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 8975537 |
| Molecular Formula | C17H14BrF2NO3 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-bromo-4-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(F)cc1Br)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14BrF2NO3/c1-10(16(22)21-9-11-2-4-12(19)5-3-11)24-17(23)14-7-6-13(20)8-15(14)18/h2-8,10H,9H2,1H3,(H,21,22)/t10-/m0/s1 |
| InChIKey | ZHYQWJYGAQKZRW-JTQLQIEISA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |