C18H17BrFNO4 — CID 55420534
[1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-bromo-5-methoxybenzoate (PubChem CID 55420534) has the molecular formula C18H17BrFNO4 and a molecular weight of 410.24 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-bromo-5-methoxybenzoate.
| Compound Name | [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-bromo-5-methoxybenzoate |
|---|---|
| PubChem CID | 55420534 |
| Molecular Formula | C18H17BrFNO4 |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-bromo-5-methoxybenzoate |
| SMILES | COc1ccc(Br)c(C(=O)OC(C)C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H17BrFNO4/c1-11(17(22)21-10-12-3-5-13(20)6-4-12)25-18(23)15-9-14(24-2)7-8-16(15)19/h3-9,11H,10H2,1-2H3,(H,21,22) |
| InChIKey | FPYOVJCPKRVEHS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |