C12H14ClNO3 — CID 43141838
2-(4-chloro-2-formylphenoxy)-N,N-dimethylpropanamide (PubChem CID 43141838) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 2-(4-chloro-2-formylphenoxy)-N,N-dimethylpropanamide.
| Compound Name | 2-(4-chloro-2-formylphenoxy)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43141838 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-(4-chloro-2-formylphenoxy)-N,N-dimethylpropanamide |
| SMILES | CC(Oc1ccc(Cl)cc1C=O)C(=O)N(C)C |
| InChI | InChI=1S/C12H14ClNO3/c1-8(12(16)14(2)3)17-11-5-4-10(13)6-9(11)7-15/h4-8H,1-3H3 |
| InChIKey | WJOREMQTLVOSGX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|