C12H15F2N3O2S — CID 40633643
1-[[(2R)-2-(2,4-difluorophenoxy)propanoyl]amino]-3-ethylthiourea (PubChem CID 40633643) has the molecular formula C12H15F2N3O2S and a molecular weight of 303.33 g/mol. Its IUPAC name is 1-[[(2R)-2-(2,4-difluorophenoxy)propanoyl]amino]-3-ethylthiourea.
| Compound Name | 1-[[(2R)-2-(2,4-difluorophenoxy)propanoyl]amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 40633643 |
| Molecular Formula | C12H15F2N3O2S |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-[[(2R)-2-(2,4-difluorophenoxy)propanoyl]amino]-3-ethylthiourea |
| SMILES | CCNC(=S)NNC(=O)[C@@H](C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2N3O2S/c1-3-15-12(20)17-16-11(18)7(2)19-10-5-4-8(13)6-9(10)14/h4-7H,3H2,1-2H3,(H,16,18)(H2,15,17,20)/t7-/m1/s1 |
| InChIKey | JZKIFFMVIFWPAI-SSDOTTSWSA-N |
| XLogP | 1.25 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|