C10H10F2O3 — CID 4507460
methyl 2-(2,4-difluorophenoxy)propanoate (PubChem CID 4507460) has the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. Its IUPAC name is methyl 2-(2,4-difluorophenoxy)propanoate.
| Compound Name | methyl 2-(2,4-difluorophenoxy)propanoate |
|---|---|
| PubChem CID | 4507460 |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | methyl 2-(2,4-difluorophenoxy)propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C10H10F2O3/c1-6(10(13)14-2)15-9-4-3-7(11)5-8(9)12/h3-6H,1-2H3 |
| InChIKey | OAAVRCUDXMSPGR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |