C11H14F2N2O2 — CID 63575446
4-(2,4-difluorophenoxy)pentanehydrazide (PubChem CID 63575446) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)pentanehydrazide.
| Compound Name | 4-(2,4-difluorophenoxy)pentanehydrazide |
|---|---|
| PubChem CID | 63575446 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-(2,4-difluorophenoxy)pentanehydrazide |
| SMILES | CC(CCC(=O)NN)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C11H14F2N2O2/c1-7(2-5-11(16)15-14)17-10-4-3-8(12)6-9(10)13/h3-4,6-7H,2,5,14H2,1H3,(H,15,16) |
| InChIKey | DQSSSGFXZOBKJH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|