C14H20ClN3O2S — CID 4503596
1-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-3-ethylthiourea (PubChem CID 4503596) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is 1-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-3-ethylthiourea.
| Compound Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 4503596 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NNC(=O)C(C)Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C14H20ClN3O2S/c1-5-16-14(21)18-17-13(19)10(4)20-11-6-8(2)12(15)9(3)7-11/h6-7,10H,5H2,1-4H3,(H,17,19)(H2,16,18,21) |
| InChIKey | WKGYIRWZZYKIPY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|