C13H19N3O2S — CID 40724448
1-[[(2R)-2-(3,5-dimethylphenoxy)propanoyl]amino]-3-methylthiourea (PubChem CID 40724448) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-[[(2R)-2-(3,5-dimethylphenoxy)propanoyl]amino]-3-methylthiourea.
| Compound Name | 1-[[(2R)-2-(3,5-dimethylphenoxy)propanoyl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 40724448 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[[(2R)-2-(3,5-dimethylphenoxy)propanoyl]amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)[C@@H](C)Oc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H19N3O2S/c1-8-5-9(2)7-11(6-8)18-10(3)12(17)15-16-13(19)14-4/h5-7,10H,1-4H3,(H,15,17)(H2,14,16,19)/t10-/m1/s1 |
| InChIKey | UIXFXAMAUBUSRJ-SNVBAGLBSA-N |
| XLogP | 1.20 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|