C15H23N3O2S — CID 4503397
1-[2-(3,4-dimethylphenoxy)butanoylamino]-3-ethylthiourea (PubChem CID 4503397) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenoxy)butanoylamino]-3-ethylthiourea.
| Compound Name | 1-[2-(3,4-dimethylphenoxy)butanoylamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 4503397 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-[2-(3,4-dimethylphenoxy)butanoylamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NNC(=O)C(CC)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H23N3O2S/c1-5-13(14(19)17-18-15(21)16-6-2)20-12-8-7-10(3)11(4)9-12/h7-9,13H,5-6H2,1-4H3,(H,17,19)(H2,16,18,21) |
| InChIKey | CROIYJDAKIATAO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|