C17H25N3O3S — CID 17169527
N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]pentanamide (PubChem CID 17169527) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]pentanamide.
| Compound Name | N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 17169527 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[[2-(3,4-dimethylphenoxy)propanoylamino]carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)NNC(=O)C(C)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H25N3O3S/c1-5-6-7-15(21)18-17(24)20-19-16(22)13(4)23-14-9-8-11(2)12(3)10-14/h8-10,13H,5-7H2,1-4H3,(H,19,22)(H2,18,20,21,24) |
| InChIKey | AHYVONXBANOTIJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|