C20H23N3O5S — CID 4940374
ethyl 4-[(2-naphthalen-2-yloxypropanoylamino)carbamothioylamino]-4-oxobutanoate (PubChem CID 4940374) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is ethyl 4-[(2-naphthalen-2-yloxypropanoylamino)carbamothioylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[(2-naphthalen-2-yloxypropanoylamino)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4940374 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | ethyl 4-[(2-naphthalen-2-yloxypropanoylamino)carbamothioylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC(=S)NNC(=O)C(C)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H23N3O5S/c1-3-27-18(25)11-10-17(24)21-20(29)23-22-19(26)13(2)28-16-9-8-14-6-4-5-7-15(14)12-16/h4-9,12-13H,3,10-11H2,1-2H3,(H,22,26)(H2,21,23,24,29) |
| InChIKey | DISZKABLSQNRML-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|