C14H13FN3S+ — CID 3652016
(4-fluorophenyl)methylidene-(phenylcarbamothioylamino)azanium (PubChem CID 3652016) has the molecular formula C14H13FN3S+ and a molecular weight of 274.34 g/mol. Its IUPAC name is (4-fluorophenyl)methylidene-(phenylcarbamothioylamino)azanium.
| Compound Name | (4-fluorophenyl)methylidene-(phenylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 3652016 |
| Molecular Formula | C14H13FN3S+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (4-fluorophenyl)methylidene-(phenylcarbamothioylamino)azanium |
| SMILES | Fc1ccc(C=[NH+]NC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C14H12FN3S/c15-12-8-6-11(7-9-12)10-16-18-14(19)17-13-4-2-1-3-5-13/h1-10H,(H2,17,18,19)/p+1 |
| InChIKey | XGDGKLGXGAALNB-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|