C16H17FN4S2 — CID 8654152
1-(4-fluorophenyl)-3-(2-phenylethylcarbamothioylamino)thiourea (PubChem CID 8654152) has the molecular formula C16H17FN4S2 and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(2-phenylethylcarbamothioylamino)thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-(2-phenylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8654152 |
| Molecular Formula | C16H17FN4S2 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(2-phenylethylcarbamothioylamino)thiourea |
| SMILES | Fc1ccc(NC(=S)NNC(=S)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17FN4S2/c17-13-6-8-14(9-7-13)19-16(23)21-20-15(22)18-11-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H2,18,20,22)(H2,19,21,23) |
| InChIKey | ZTVUVRZGKYRVNX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|