C17H20N4S2 — CID 8001105
1-(4-methylphenyl)-3-(2-phenylethylcarbamothioylamino)thiourea (PubChem CID 8001105) has the molecular formula C17H20N4S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(2-phenylethylcarbamothioylamino)thiourea.
| Compound Name | 1-(4-methylphenyl)-3-(2-phenylethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8001105 |
| Molecular Formula | C17H20N4S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-(4-methylphenyl)-3-(2-phenylethylcarbamothioylamino)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=S)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N4S2/c1-13-7-9-15(10-8-13)19-17(23)21-20-16(22)18-12-11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H2,18,20,22)(H2,19,21,23) |
| InChIKey | CWZGERHXQWTHQF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|