C16H18N2O2S — CID 23821363
1-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-methylphenyl)thiourea (PubChem CID 23821363) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 23821363 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H18N2O2S/c1-11-2-5-13(6-3-11)18-16(21)17-9-8-12-4-7-14(19)15(20)10-12/h2-7,10,19-20H,8-9H2,1H3,(H2,17,18,21) |
| InChIKey | MNJBHGOUIKMIDY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|