C15H22N6O2S2 — CID 46234716
1-[2-(3,4-dihydroxyphenyl)ethyl]-3-[(Z)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea (PubChem CID 46234716) has the molecular formula C15H22N6O2S2 and a molecular weight of 382.52 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-[(Z)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea.
| Compound Name | 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-[(Z)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 46234716 |
| Molecular Formula | C15H22N6O2S2 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-[(Z)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea |
| SMILES | CNC(=S)N/N=C(C)/C(C)=N\NC(=S)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H22N6O2S2/c1-9(18-20-14(24)16-3)10(2)19-21-15(25)17-7-6-11-4-5-12(22)13(23)8-11/h4-5,8,22-23H,6-7H2,1-3H3,(H2,16,20,24)(H2,17,21,25)/b18-9+,19-10- |
| InChIKey | UKNKRPLBPVMXGR-LRPCQRGVSA-N |
| XLogP | 0.95 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|