C14H21N7S2 — CID 167361236
1-methyl-3-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-5-pyridin-4-ylpentan-3-ylidene]amino]thiourea (PubChem CID 167361236) has the molecular formula C14H21N7S2 and a molecular weight of 351.51 g/mol. Its IUPAC name is 1-methyl-3-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-5-pyridin-4-ylpentan-3-ylidene]amino]thiourea.
| Compound Name | 1-methyl-3-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-5-pyridin-4-ylpentan-3-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 167361236 |
| Molecular Formula | C14H21N7S2 |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-methyl-3-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-5-pyridin-4-ylpentan-3-ylidene]amino]thiourea |
| SMILES | CNC(=S)N/N=C(C)/C(CCc1ccncc1)=N/NC(=S)NC |
| InChI | InChI=1S/C14H21N7S2/c1-10(18-20-13(22)15-2)12(19-21-14(23)16-3)5-4-11-6-8-17-9-7-11/h6-9H,4-5H2,1-3H3,(H2,15,20,22)(H2,16,21,23)/b18-10+,19-12+ |
| InChIKey | KQRDEYBGDBEMOA-UBIAKTOFSA-N |
| XLogP | 0.93 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|