C9H16N6OS2 — CID 177462498
1-methyl-3-[(E)-[(4E)-4-(methylcarbamothioylhydrazinylidene)-3-oxopentan-2-ylidene]amino]thiourea (PubChem CID 177462498) has the molecular formula C9H16N6OS2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 1-methyl-3-[(E)-[(4E)-4-(methylcarbamothioylhydrazinylidene)-3-oxopentan-2-ylidene]amino]thiourea.
| Compound Name | 1-methyl-3-[(E)-[(4E)-4-(methylcarbamothioylhydrazinylidene)-3-oxopentan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 177462498 |
| Molecular Formula | C9H16N6OS2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-methyl-3-[(E)-[(4E)-4-(methylcarbamothioylhydrazinylidene)-3-oxopentan-2-ylidene]amino]thiourea |
| SMILES | CNC(=S)N/N=C(\C)C(=O)/C(C)=N/NC(=S)NC |
| InChI | InChI=1S/C9H16N6OS2/c1-5(12-14-8(17)10-3)7(16)6(2)13-15-9(18)11-4/h1-4H3,(H2,10,14,17)(H2,11,15,18)/b12-5+,13-6+ |
| InChIKey | XJMQJOJHSRGVLJ-BYDSPXIWSA-N |
| XLogP | -0.50 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|