C16H22N6O2S2 — CID 58544828
2-[[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioylamino]-3-phenylpropanoic acid (PubChem CID 58544828) has the molecular formula C16H22N6O2S2 and a molecular weight of 394.53 g/mol. Its IUPAC name is 2-[[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 58544828 |
| Molecular Formula | C16H22N6O2S2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioylamino]-3-phenylpropanoic acid |
| SMILES | CNC(=S)N/N=C(C)/C(C)=N/NC(=S)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H22N6O2S2/c1-10(19-21-15(25)17-3)11(2)20-22-16(26)18-13(14(23)24)9-12-7-5-4-6-8-12/h4-8,13H,9H2,1-3H3,(H,23,24)(H2,17,21,25)(H2,18,22,26)/b19-10+,20-11+ |
| InChIKey | YAGWFLZSPGKBIM-ROUMAOROSA-N |
| XLogP | 0.99 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|