C11H13NO2S2 — CID 10824922
(2S)-2-(methylsulfanylcarbothioylamino)-3-phenylpropanoic acid (PubChem CID 10824922) has the molecular formula C11H13NO2S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is (2S)-2-(methylsulfanylcarbothioylamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-(methylsulfanylcarbothioylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10824922 |
| Molecular Formula | C11H13NO2S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (2S)-2-(methylsulfanylcarbothioylamino)-3-phenylpropanoic acid |
| SMILES | CSC(=S)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13NO2S2/c1-16-11(15)12-9(10(13)14)7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,12,15)(H,13,14)/t9-/m0/s1 |
| InChIKey | CDLOYQQDYGARJF-VIFPVBQESA-N |
| XLogP | 1.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|