C12H17N2O3+ — CID 156619966
[(2S)-1-[[(1S)-1-carboxy-2-phenylethyl]amino]-1-oxopropan-2-yl]azanium (PubChem CID 156619966) has the molecular formula C12H17N2O3+ and a molecular weight of 237.28 g/mol. Its IUPAC name is [(2S)-1-[[(1S)-1-carboxy-2-phenylethyl]amino]-1-oxopropan-2-yl]azanium.
| Compound Name | [(2S)-1-[[(1S)-1-carboxy-2-phenylethyl]amino]-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 156619966 |
| Molecular Formula | C12H17N2O3+ |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [(2S)-1-[[(1S)-1-carboxy-2-phenylethyl]amino]-1-oxopropan-2-yl]azanium |
| SMILES | C[C@H]([NH3+])C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/p+1/t8-,10-/m0/s1 |
| InChIKey | OMNVYXHOSHNURL-WPRPVWTQSA-O |
| XLogP | -0.57 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |