C14H18BrNO3 — CID 102267737
(2S)-2-[(2-bromo-3-methylbutanoyl)amino]-3-phenylpropanoic acid (PubChem CID 102267737) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is (2S)-2-[(2-bromo-3-methylbutanoyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(2-bromo-3-methylbutanoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 102267737 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (2S)-2-[(2-bromo-3-methylbutanoyl)amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C(Br)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H18BrNO3/c1-9(2)12(15)13(17)16-11(14(18)19)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3,(H,16,17)(H,18,19)/t11-,12?/m0/s1 |
| InChIKey | RGIHFSFFOHEHAX-PXYINDEMSA-N |
| XLogP | 2.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|