C14H19NO2S — CID 11459778
2-(3-methylbutanethioylamino)-3-phenylpropanoic acid (PubChem CID 11459778) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(3-methylbutanethioylamino)-3-phenylpropanoic acid.
| Compound Name | 2-(3-methylbutanethioylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11459778 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(3-methylbutanethioylamino)-3-phenylpropanoic acid |
| SMILES | CC(C)CC(=S)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H19NO2S/c1-10(2)8-13(18)15-12(14(16)17)9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | DGPRAHGWTZCQKN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|