C13H20N2O4 — CID 67559512
(2S)-2-aminopropanoic acid;(2S)-2-(methylamino)-3-phenylpropanoic acid (PubChem CID 67559512) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;(2S)-2-(methylamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-aminopropanoic acid;(2S)-2-(methylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67559512 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (2S)-2-aminopropanoic acid;(2S)-2-(methylamino)-3-phenylpropanoic acid |
| SMILES | CN[C@@H](Cc1ccccc1)C(=O)O.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H13NO2.C3H7NO2/c1-11-9(10(12)13)7-8-5-3-2-4-6-8;1-2(4)3(5)6/h2-6,9,11H,7H2,1H3,(H,12,13);2H,4H2,1H3,(H,5,6)/t9-;2-/m00/s1 |
| InChIKey | SYSGRPUQLICKBH-HRDPVCSZSA-N |
| XLogP | 0.32 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |