C12H18N2O3 — CID 163483257
methanamine;(3S)-3-(methylamino)-2-oxo-4-phenylbutanoic acid (PubChem CID 163483257) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is methanamine;(3S)-3-(methylamino)-2-oxo-4-phenylbutanoic acid.
| Compound Name | methanamine;(3S)-3-(methylamino)-2-oxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 163483257 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methanamine;(3S)-3-(methylamino)-2-oxo-4-phenylbutanoic acid |
| SMILES | CN.CN[C@@H](Cc1ccccc1)C(=O)C(=O)O |
| InChI | InChI=1S/C11H13NO3.CH5N/c1-12-9(10(13)11(14)15)7-8-5-3-2-4-6-8;1-2/h2-6,9,12H,7H2,1H3,(H,14,15);2H2,1H3/t9-;/m0./s1 |
| InChIKey | CGJWUQJESVPGQE-FVGYRXGTSA-N |
| XLogP | 0.05 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|