C12H22N6O2S3 — CID 123524907
2-[[(Z)-[(3Z)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioylamino]-4-methylsulfanylbutanoic acid (PubChem CID 123524907) has the molecular formula C12H22N6O2S3 and a molecular weight of 378.55 g/mol. Its IUPAC name is 2-[[(Z)-[(3Z)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-[(3Z)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 123524907 |
| Molecular Formula | C12H22N6O2S3 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-[[(Z)-[(3Z)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CNC(=S)N/N=C(C)\C(C)=N/NC(=S)NC(CCSC)C(=O)O |
| InChI | InChI=1S/C12H22N6O2S3/c1-7(15-17-11(21)13-3)8(2)16-18-12(22)14-9(10(19)20)5-6-23-4/h9H,5-6H2,1-4H3,(H,19,20)(H2,13,17,21)(H2,14,18,22)/b15-7-,16-8- |
| InChIKey | LQMQJSZLSVIYJP-DUGOVBPYSA-N |
| XLogP | 0.50 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|