C14H18N6OS2 — CID 142539455
1-[(E)-[(1E)-1-(4-formylphenyl)-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-methylthiourea (PubChem CID 142539455) has the molecular formula C14H18N6OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-[(E)-[(1E)-1-(4-formylphenyl)-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-methylthiourea.
| Compound Name | 1-[(E)-[(1E)-1-(4-formylphenyl)-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 142539455 |
| Molecular Formula | C14H18N6OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-[(E)-[(1E)-1-(4-formylphenyl)-1-(methylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C(C)/C(=N/NC(=S)NC)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C14H18N6OS2/c1-9(17-19-13(22)15-2)12(18-20-14(23)16-3)11-6-4-10(8-21)5-7-11/h4-8H,1-3H3,(H2,15,19,22)(H2,16,20,23)/b17-9+,18-12- |
| InChIKey | JNUJGBBTQMDXKH-HFXFAIJXSA-N |
| XLogP | 0.77 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|