C18H18N6OS2 — CID 142539195
1-[(E)-[(2E)-2-(carbamothioylhydrazinylidene)-1-(4-formylphenyl)-2-phenylethylidene]amino]-3-methylthiourea (PubChem CID 142539195) has the molecular formula C18H18N6OS2 and a molecular weight of 398.52 g/mol. Its IUPAC name is 1-[(E)-[(2E)-2-(carbamothioylhydrazinylidene)-1-(4-formylphenyl)-2-phenylethylidene]amino]-3-methylthiourea.
| Compound Name | 1-[(E)-[(2E)-2-(carbamothioylhydrazinylidene)-1-(4-formylphenyl)-2-phenylethylidene]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 142539195 |
| Molecular Formula | C18H18N6OS2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[(E)-[(2E)-2-(carbamothioylhydrazinylidene)-1-(4-formylphenyl)-2-phenylethylidene]amino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C(C(=N/NC(N)=S)/c1ccccc1)\c1ccc(C=O)cc1 |
| InChI | InChI=1S/C18H18N6OS2/c1-20-18(27)24-22-16(14-9-7-12(11-25)8-10-14)15(21-23-17(19)26)13-5-3-2-4-6-13/h2-11H,1H3,(H3,19,23,26)(H2,20,24,27)/b21-15+,22-16+ |
| InChIKey | NLOKDKDCYUWCIV-YHARCJFQSA-N |
| XLogP | 1.53 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|