C36H33BrN6PS2+ — CID 158385933
[[[2-(4-bromophenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]methyl-triphenylphosphanium (PubChem CID 158385933) has the molecular formula C36H33BrN6PS2+ and a molecular weight of 724.71 g/mol. Its IUPAC name is [[[2-(4-bromophenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]methyl-triphenylphosphanium.
| Compound Name | [[[2-(4-bromophenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 158385933 |
| Molecular Formula | C36H33BrN6PS2+ |
| Molecular Weight | 724.71 g/mol |
| Exact Mass | 723.11 |
| IUPAC Name | [[[2-(4-bromophenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]methyl-triphenylphosphanium |
| SMILES | CNC(=S)NN=C(C(=NNC(=S)NC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C36H32BrN6PS2/c1-38-35(45)42-40-34(28-22-24-29(37)25-23-28)33(27-14-6-2-7-15-27)41-43-36(46)39-26-44(30-16-8-3-9-17-30,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h2-25H,26H2,1H3,(H3-,38,39,40,41,42,43,45,46)/p+1 |
| InChIKey | BDEKEPPNKIXUKB-UHFFFAOYSA-O |
| XLogP | 6.07 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|