C15H18BrF3N6S2 — CID 153080280
1-[[1-(4-bromophenyl)-2-(ethylcarbamothioylhydrazinylidene)propylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 153080280) has the molecular formula C15H18BrF3N6S2 and a molecular weight of 483.38 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)-2-(ethylcarbamothioylhydrazinylidene)propylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[[1-(4-bromophenyl)-2-(ethylcarbamothioylhydrazinylidene)propylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 153080280 |
| Molecular Formula | C15H18BrF3N6S2 |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 1-[[1-(4-bromophenyl)-2-(ethylcarbamothioylhydrazinylidene)propylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | CCNC(=S)NN=C(C)C(=NNC(=S)NCC(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H18BrF3N6S2/c1-3-20-13(26)24-22-9(2)12(10-4-6-11(16)7-5-10)23-25-14(27)21-8-15(17,18)19/h4-7H,3,8H2,1-2H3,(H2,20,24,26)(H2,21,25,27) |
| InChIKey | IBBLIDBIYPUJGZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|