C19H32N8OS2 — CID 162741103
1-ethyl-3-[(E)-[(1Z)-1-(ethylcarbamothioylhydrazinylidene)-1-[5-[(4-methylpiperazin-1-yl)methyl]furan-2-yl]propan-2-ylidene]amino]thiourea (PubChem CID 162741103) has the molecular formula C19H32N8OS2 and a molecular weight of 452.65 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-[(1Z)-1-(ethylcarbamothioylhydrazinylidene)-1-[5-[(4-methylpiperazin-1-yl)methyl]furan-2-yl]propan-2-ylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[(E)-[(1Z)-1-(ethylcarbamothioylhydrazinylidene)-1-[5-[(4-methylpiperazin-1-yl)methyl]furan-2-yl]propan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 162741103 |
| Molecular Formula | C19H32N8OS2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 1-ethyl-3-[(E)-[(1Z)-1-(ethylcarbamothioylhydrazinylidene)-1-[5-[(4-methylpiperazin-1-yl)methyl]furan-2-yl]propan-2-ylidene]amino]thiourea |
| SMILES | CCNC(=S)N/N=C(C(/C)=N/NC(=S)NCC)\c1ccc(CN2CCN(C)CC2)o1 |
| InChI | InChI=1S/C19H32N8OS2/c1-5-20-18(29)24-22-14(3)17(23-25-19(30)21-6-2)16-8-7-15(28-16)13-27-11-9-26(4)10-12-27/h7-8H,5-6,9-13H2,1-4H3,(H2,20,24,29)(H2,21,25,30)/b22-14+,23-17- |
| InChIKey | FAJNNOAAZKWWAQ-PBDXNDDNSA-N |
| XLogP | 1.08 |
| TPSA | 92.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|