C21H35N7OS2 — CID 162740793
1-methyl-3-[(E)-[(1Z)-1-(methylcarbamothioylhydrazinylidene)-1-[5-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]furan-2-yl]propan-2-ylidene]amino]thiourea (PubChem CID 162740793) has the molecular formula C21H35N7OS2 and a molecular weight of 465.69 g/mol. Its IUPAC name is 1-methyl-3-[(E)-[(1Z)-1-(methylcarbamothioylhydrazinylidene)-1-[5-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]furan-2-yl]propan-2-ylidene]amino]thiourea.
| Compound Name | 1-methyl-3-[(E)-[(1Z)-1-(methylcarbamothioylhydrazinylidene)-1-[5-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]furan-2-yl]propan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 162740793 |
| Molecular Formula | C21H35N7OS2 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 1-methyl-3-[(E)-[(1Z)-1-(methylcarbamothioylhydrazinylidene)-1-[5-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]furan-2-yl]propan-2-ylidene]amino]thiourea |
| SMILES | CNC(=S)N/N=C(C(/C)=N/NC(=S)NC)\c1ccc(CN2C(C)(C)CCCC2(C)C)o1 |
| InChI | InChI=1S/C21H35N7OS2/c1-14(24-26-18(30)22-6)17(25-27-19(31)23-7)16-10-9-15(29-16)13-28-20(2,3)11-8-12-21(28,4)5/h9-10H,8,11-13H2,1-7H3,(H2,22,26,30)(H2,23,27,31)/b24-14+,25-17- |
| InChIKey | DYJCYJAWUZVMKX-MNXXMNJASA-N |
| XLogP | 3.09 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|