C22H37N7OS2 — CID 162740763
1-ethyl-3-[(E)-[(2E)-2-(ethylcarbamothioylhydrazinylidene)-1-[5-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]furan-2-yl]ethylidene]amino]thiourea (PubChem CID 162740763) has the molecular formula C22H37N7OS2 and a molecular weight of 479.72 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-[(2E)-2-(ethylcarbamothioylhydrazinylidene)-1-[5-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]furan-2-yl]ethylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[(E)-[(2E)-2-(ethylcarbamothioylhydrazinylidene)-1-[5-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]furan-2-yl]ethylidene]amino]thiourea |
|---|---|
| PubChem CID | 162740763 |
| Molecular Formula | C22H37N7OS2 |
| Molecular Weight | 479.72 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 1-ethyl-3-[(E)-[(2E)-2-(ethylcarbamothioylhydrazinylidene)-1-[5-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]furan-2-yl]ethylidene]amino]thiourea |
| SMILES | CCNC(=S)N/N=C/C(=N\NC(=S)NCC)c1ccc(CN2C(C)(C)CCCC2(C)C)o1 |
| InChI | InChI=1S/C22H37N7OS2/c1-7-23-19(31)27-25-14-17(26-28-20(32)24-8-2)18-11-10-16(30-18)15-29-21(3,4)12-9-13-22(29,5)6/h10-11,14H,7-9,12-13,15H2,1-6H3,(H2,23,27,31)(H2,24,28,32)/b25-14+,26-17+ |
| InChIKey | XFVNIHFNJHIPFS-ZVEROZJISA-N |
| XLogP | 3.48 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|