C8H12N4S — CID 135468189
1-ethyl-3-[(E)-1H-pyrrol-2-ylmethylideneamino]thiourea (PubChem CID 135468189) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-1H-pyrrol-2-ylmethylideneamino]thiourea.
| Compound Name | 1-ethyl-3-[(E)-1H-pyrrol-2-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 135468189 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-ethyl-3-[(E)-1H-pyrrol-2-ylmethylideneamino]thiourea |
| SMILES | CCNC(=S)N/N=C/c1ccc[nH]1 |
| InChI | InChI=1S/C8H12N4S/c1-2-9-8(13)12-11-6-7-4-3-5-10-7/h3-6,10H,2H2,1H3,(H2,9,12,13)/b11-6+ |
| InChIKey | NPHZHJZPCVFARB-IZZDOVSWSA-N |
| XLogP | 0.83 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|