C7H11N5S — CID 137272915
1-ethyl-3-[(E)-1H-pyrazol-5-ylmethylideneamino]thiourea (PubChem CID 137272915) has the molecular formula C7H11N5S and a molecular weight of 197.27 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-1H-pyrazol-5-ylmethylideneamino]thiourea.
| Compound Name | 1-ethyl-3-[(E)-1H-pyrazol-5-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 137272915 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1-ethyl-3-[(E)-1H-pyrazol-5-ylmethylideneamino]thiourea |
| SMILES | CCNC(=S)N/N=C/c1ccn[nH]1 |
| InChI | InChI=1S/C7H11N5S/c1-2-8-7(13)12-10-5-6-3-4-9-11-6/h3-5H,2H2,1H3,(H,9,11)(H2,8,12,13)/b10-5+ |
| InChIKey | VCXWMIIDSJLPMB-BJMVGYQFSA-N |
| XLogP | 0.23 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|