C10H17N3O5S — CID 139079977
1-ethyl-3-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]thiourea;dihydrate (PubChem CID 139079977) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]thiourea;dihydrate.
| Compound Name | 1-ethyl-3-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]thiourea;dihydrate |
|---|---|
| PubChem CID | 139079977 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-ethyl-3-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]thiourea;dihydrate |
| SMILES | CCNC(=S)N/N=C/c1c(O)cc(O)cc1O.O.O |
| InChI | InChI=1S/C10H13N3O3S.2H2O/c1-2-11-10(17)13-12-5-7-8(15)3-6(14)4-9(7)16;;/h3-5,14-16H,2H2,1H3,(H2,11,13,17);2*1H2/b12-5+;; |
| InChIKey | PKNWCWWYPQCDNP-ORQKEDRFSA-N |
| XLogP | -1.03 |
| TPSA | 160.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|