C10H11Br2N3OS — CID 135625883
1-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-ethylthiourea (PubChem CID 135625883) has the molecular formula C10H11Br2N3OS and a molecular weight of 381.09 g/mol. Its IUPAC name is 1-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 135625883 |
| Molecular Formula | C10H11Br2N3OS |
| Molecular Weight | 381.09 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | 1-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C10H11Br2N3OS/c1-2-13-10(17)15-14-5-6-3-7(11)9(16)8(12)4-6/h3-5,16H,2H2,1H3,(H2,13,15,17)/b14-5+ |
| InChIKey | QZFDHXIMYOBBAR-LHHJGKSTSA-N |
| XLogP | 2.74 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.09 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|