C17H16Br2FN3OS — CID 126375763
1-[(Z)-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea (PubChem CID 126375763) has the molecular formula C17H16Br2FN3OS and a molecular weight of 489.21 g/mol. Its IUPAC name is 1-[(Z)-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 126375763 |
| Molecular Formula | C17H16Br2FN3OS |
| Molecular Weight | 489.21 g/mol |
| Exact Mass | 486.94 |
| IUPAC Name | 1-[(Z)-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1cc(Br)c(OCc2ccccc2F)c(Br)c1 |
| InChI | InChI=1S/C17H16Br2FN3OS/c1-2-21-17(25)23-22-9-11-7-13(18)16(14(19)8-11)24-10-12-5-3-4-6-15(12)20/h3-9H,2,10H2,1H3,(H2,21,23,25)/b22-9- |
| InChIKey | DJLNHGSGXFGNGH-AFPJDJCSSA-N |
| XLogP | 4.75 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.21 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|