C17H16Cl2FN3OS — CID 5001541
1-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea (PubChem CID 5001541) has the molecular formula C17H16Cl2FN3OS and a molecular weight of 400.31 g/mol. Its IUPAC name is 1-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 5001541 |
| Molecular Formula | C17H16Cl2FN3OS |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 1-[[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NN=Cc1cc(Cl)c(OCc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2FN3OS/c1-2-21-17(25)23-22-9-12-7-14(18)16(15(19)8-12)24-10-11-4-3-5-13(20)6-11/h3-9H,2,10H2,1H3,(H2,21,23,25) |
| InChIKey | WMILMIVKOPSYNE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|