C18H19I2N3OS — CID 126375619
1-[(Z)-[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea (PubChem CID 126375619) has the molecular formula C18H19I2N3OS and a molecular weight of 579.25 g/mol. Its IUPAC name is 1-[(Z)-[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 126375619 |
| Molecular Formula | C18H19I2N3OS |
| Molecular Weight | 579.25 g/mol |
| Exact Mass | 578.93 |
| IUPAC Name | 1-[(Z)-[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1cc(I)c(OCc2cccc(C)c2)c(I)c1 |
| InChI | InChI=1S/C18H19I2N3OS/c1-3-21-18(25)23-22-10-14-8-15(19)17(16(20)9-14)24-11-13-6-4-5-12(2)7-13/h4-10H,3,11H2,1-2H3,(H2,21,23,25)/b22-10- |
| InChIKey | BIVLJQWTZDTQOF-YVNNLAQVSA-N |
| XLogP | 4.60 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.25 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|