C21H19I2N3OS — CID 126377218
1-[(Z)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-ethylthiourea (PubChem CID 126377218) has the molecular formula C21H19I2N3OS and a molecular weight of 615.28 g/mol. Its IUPAC name is 1-[(Z)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 126377218 |
| Molecular Formula | C21H19I2N3OS |
| Molecular Weight | 615.28 g/mol |
| Exact Mass | 614.93 |
| IUPAC Name | 1-[(Z)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1cc(I)c(OCc2cccc3ccccc23)c(I)c1 |
| InChI | InChI=1S/C21H19I2N3OS/c1-2-24-21(28)26-25-12-14-10-18(22)20(19(23)11-14)27-13-16-8-5-7-15-6-3-4-9-17(15)16/h3-12H,2,13H2,1H3,(H2,24,26,28)/b25-12- |
| InChIKey | MFOBNMQFQZITIW-ROTLSHHCSA-N |
| XLogP | 5.45 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.28 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|