C28H24I2N2O2 — CID 126367547
N-[(E)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-ethylphenyl)acetamide (PubChem CID 126367547) has the molecular formula C28H24I2N2O2 and a molecular weight of 674.32 g/mol. Its IUPAC name is N-[(E)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[(E)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126367547 |
| Molecular Formula | C28H24I2N2O2 |
| Molecular Weight | 674.32 g/mol |
| Exact Mass | 673.99 |
| IUPAC Name | N-[(E)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(CC(=O)N/N=C/c2cc(I)c(OCc3cccc4ccccc34)c(I)c2)cc1 |
| InChI | InChI=1S/C28H24I2N2O2/c1-2-19-10-12-20(13-11-19)16-27(33)32-31-17-21-14-25(29)28(26(30)15-21)34-18-23-8-5-7-22-6-3-4-9-24(22)23/h3-15,17H,2,16,18H2,1H3,(H,32,33)/b31-17+ |
| InChIKey | IZZGHWOIIHIPEB-KBVAKVRCSA-N |
| XLogP | 6.88 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.32 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|