C24H23I2N3O3 — CID 124602142
N-[(E)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 124602142) has the molecular formula C24H23I2N3O3 and a molecular weight of 655.27 g/mol. Its IUPAC name is N-[(E)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 124602142 |
| Molecular Formula | C24H23I2N3O3 |
| Molecular Weight | 655.27 g/mol |
| Exact Mass | 654.98 |
| IUPAC Name | N-[(E)-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)N/N=C/c1cc(I)c(OCc2cccc3ccccc23)c(I)c1 |
| InChI | InChI=1S/C24H23I2N3O3/c25-21-12-17(14-27-28-23(30)15-29-8-10-31-11-9-29)13-22(26)24(21)32-16-19-6-3-5-18-4-1-2-7-20(18)19/h1-7,12-14H,8-11,15-16H2,(H,28,30)/b27-14+ |
| InChIKey | MQQSHHZZAMJYBI-MZJWZYIUSA-N |
| XLogP | 4.41 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|