C22H25ClIN3O4 — CID 124533896
N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 124533896) has the molecular formula C22H25ClIN3O4 and a molecular weight of 557.82 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 124533896 |
| Molecular Formula | C22H25ClIN3O4 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CN2CCOCC2)cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H25ClIN3O4/c1-2-30-20-12-17(13-25-26-21(28)14-27-7-9-29-10-8-27)11-19(24)22(20)31-15-16-3-5-18(23)6-4-16/h3-6,11-13H,2,7-10,14-15H2,1H3,(H,26,28)/b25-13- |
| InChIKey | RUUWKJNMMSZSNJ-MXAYSNPKSA-N |
| XLogP | 3.70 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|