C22H24ClN3O6 — CID 126005659
N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)-3-chloro-5-methoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 126005659) has the molecular formula C22H24ClN3O6 and a molecular weight of 461.90 g/mol. Its IUPAC name is N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)-3-chloro-5-methoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)-3-chloro-5-methoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 126005659 |
| Molecular Formula | C22H24ClN3O6 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)-3-chloro-5-methoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | COc1cc(/C=N/NC(=O)CN2CCOCC2)cc(Cl)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H24ClN3O6/c1-28-20-10-16(11-24-25-21(27)12-26-4-6-29-7-5-26)8-17(23)22(20)30-13-15-2-3-18-19(9-15)32-14-31-18/h2-3,8-11H,4-7,12-14H2,1H3,(H,25,27)/b24-11+ |
| InChIKey | VYLVEMYVAPZXIA-BHGWPJFGSA-N |
| XLogP | 2.44 |
| TPSA | 90.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|